C31H42N6O3 — CID 143371093
methanol;4-[7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide (PubChem CID 143371093) has the molecular formula C31H42N6O3 and a molecular weight of 546.72 g/mol. Its IUPAC name is methanol;4-[7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide.
| Compound Name | methanol;4-[7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143371093 |
| Molecular Formula | C31H42N6O3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | methanol;4-[7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide |
| SMILES | CO.O=C(Nc1ccc(N2CCCC2)cc1)N1CCC(c2ncnc3cc(OCCN4CCCC4)ccc23)CC1 |
| InChI | InChI=1S/C30H38N6O2.CH4O/c37-30(33-24-5-7-25(8-6-24)35-15-3-4-16-35)36-17-11-23(12-18-36)29-27-10-9-26(21-28(27)31-22-32-29)38-20-19-34-13-1-2-14-34;1-2/h5-10,21-23H,1-4,11-20H2,(H,33,37);2H,1H3 |
| InChIKey | APOGLKFALURDDD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|