C29H39N7O2 — CID 143371677
4-[7-[ethyl(formyl)amino]quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide;N-methylmethanamine (PubChem CID 143371677) has the molecular formula C29H39N7O2 and a molecular weight of 517.68 g/mol. Its IUPAC name is 4-[7-[ethyl(formyl)amino]quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide;N-methylmethanamine.
| Compound Name | 4-[7-[ethyl(formyl)amino]quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide;N-methylmethanamine |
|---|---|
| PubChem CID | 143371677 |
| Molecular Formula | C29H39N7O2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | 4-[7-[ethyl(formyl)amino]quinazolin-4-yl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxamide;N-methylmethanamine |
| SMILES | CCN(C=O)c1ccc2c(C3CCN(C(=O)Nc4ccc(N5CCCC5)cc4)CC3)ncnc2c1.CNC |
| InChI | InChI=1S/C27H32N6O2.C2H7N/c1-2-31(19-34)23-9-10-24-25(17-23)28-18-29-26(24)20-11-15-33(16-12-20)27(35)30-21-5-7-22(8-6-21)32-13-3-4-14-32;1-3-2/h5-10,17-20H,2-4,11-16H2,1H3,(H,30,35);3H,1-2H3 |
| InChIKey | XBXBYHKDSZMOJD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|