C30H39N7O2 — CID 58770830
4-[7-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]quinazolin-4-yl]-N-(4-morpholin-4-ylphenyl)piperidine-1-carboxamide (PubChem CID 58770830) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-[7-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]quinazolin-4-yl]-N-(4-morpholin-4-ylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[7-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]quinazolin-4-yl]-N-(4-morpholin-4-ylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58770830 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 4-[7-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]quinazolin-4-yl]-N-(4-morpholin-4-ylphenyl)piperidine-1-carboxamide |
| SMILES | CN(C)[C@@H]1CCN(c2ccc3c(C4CCN(C(=O)Nc5ccc(N6CCOCC6)cc5)CC4)ncnc3c2)C1 |
| InChI | InChI=1S/C30H39N7O2/c1-34(2)26-11-14-37(20-26)25-7-8-27-28(19-25)31-21-32-29(27)22-9-12-36(13-10-22)30(38)33-23-3-5-24(6-4-23)35-15-17-39-18-16-35/h3-8,19,21-22,26H,9-18,20H2,1-2H3,(H,33,38)/t26-/m1/s1 |
| InChIKey | STVNPMASXFEGFI-AREMUKBSSA-N |
| XLogP | 4.02 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|