C34H46N8O4 — CID 58770754
N,N-dimethyl-4-[3-[4-[1-[(4-morpholin-4-ylphenyl)carbamoyl]piperidin-4-yl]quinazolin-7-yl]oxypropyl]piperazine-1-carboxamide (PubChem CID 58770754) has the molecular formula C34H46N8O4 and a molecular weight of 630.79 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[4-[1-[(4-morpholin-4-ylphenyl)carbamoyl]piperidin-4-yl]quinazolin-7-yl]oxypropyl]piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[3-[4-[1-[(4-morpholin-4-ylphenyl)carbamoyl]piperidin-4-yl]quinazolin-7-yl]oxypropyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58770754 |
| Molecular Formula | C34H46N8O4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | N,N-dimethyl-4-[3-[4-[1-[(4-morpholin-4-ylphenyl)carbamoyl]piperidin-4-yl]quinazolin-7-yl]oxypropyl]piperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(CCCOc2ccc3c(C4CCN(C(=O)Nc5ccc(N6CCOCC6)cc5)CC4)ncnc3c2)CC1 |
| InChI | InChI=1S/C34H46N8O4/c1-38(2)34(44)42-17-15-39(16-18-42)12-3-21-46-29-8-9-30-31(24-29)35-25-36-32(30)26-10-13-41(14-11-26)33(43)37-27-4-6-28(7-5-27)40-19-22-45-23-20-40/h4-9,24-26H,3,10-23H2,1-2H3,(H,37,43) |
| InChIKey | QWCZCPBMPRKPDO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|