C31H38N6O4 — CID 58770802
N-(4-morpholin-4-ylphenyl)-4-[7-[3-(2-oxopyrrolidin-1-yl)propoxy]quinazolin-4-yl]piperidine-1-carboxamide (PubChem CID 58770802) has the molecular formula C31H38N6O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[7-[3-(2-oxopyrrolidin-1-yl)propoxy]quinazolin-4-yl]piperidine-1-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[7-[3-(2-oxopyrrolidin-1-yl)propoxy]quinazolin-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58770802 |
| Molecular Formula | C31H38N6O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[7-[3-(2-oxopyrrolidin-1-yl)propoxy]quinazolin-4-yl]piperidine-1-carboxamide |
| SMILES | O=C1CCCN1CCCOc1ccc2c(C3CCN(C(=O)Nc4ccc(N5CCOCC5)cc4)CC3)ncnc2c1 |
| InChI | InChI=1S/C31H38N6O4/c38-29-3-1-12-36(29)13-2-18-41-26-8-9-27-28(21-26)32-22-33-30(27)23-10-14-37(15-11-23)31(39)34-24-4-6-25(7-5-24)35-16-19-40-20-17-35/h4-9,21-23H,1-3,10-20H2,(H,34,39) |
| InChIKey | ASZNNWCCXZRJGH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|