C27H30N4O3S — CID 50898602
ethyl 6-[[7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 50898602) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is ethyl 6-[[7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-[[7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 50898602 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | ethyl 6-[[7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1csc2cc(Nc3ncnc4cc(OCCCN5CCCCC5)ccc34)ccc12 |
| InChI | InChI=1S/C27H30N4O3S/c1-2-33-27(32)23-17-35-25-15-19(7-9-21(23)25)30-26-22-10-8-20(16-24(22)28-18-29-26)34-14-6-13-31-11-4-3-5-12-31/h7-10,15-18H,2-6,11-14H2,1H3,(H,28,29,30) |
| InChIKey | DKPKQIUVTWRWMA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|