C15H18ClN2O+ — CID 8864141
1-[2-(4-chlorophenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 8864141) has the molecular formula C15H18ClN2O+ and a molecular weight of 277.78 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 8864141 |
| Molecular Formula | C15H18ClN2O+ |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](CCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H18ClN2O/c1-17(2)14-7-9-18(10-8-14)11-12-19-15-5-3-13(16)4-6-15/h3-10H,11-12H2,1-2H3/q+1 |
| InChIKey | ABIUMKRNCJMMKW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|