C33H35N2O4+ — CID 89398527
[2,3-dimethyl-4-[2-(4-methylphenyl)-2-oxoethyl]phenyl] 4-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethoxy]benzoate (PubChem CID 89398527) has the molecular formula C33H35N2O4+ and a molecular weight of 523.65 g/mol. Its IUPAC name is [2,3-dimethyl-4-[2-(4-methylphenyl)-2-oxoethyl]phenyl] 4-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethoxy]benzoate.
| Compound Name | [2,3-dimethyl-4-[2-(4-methylphenyl)-2-oxoethyl]phenyl] 4-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 89398527 |
| Molecular Formula | C33H35N2O4+ |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | [2,3-dimethyl-4-[2-(4-methylphenyl)-2-oxoethyl]phenyl] 4-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethoxy]benzoate |
| SMILES | Cc1ccc(C(=O)Cc2ccc(OC(=O)c3ccc(OCC[n+]4ccc(N(C)C)cc4)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C33H35N2O4/c1-23-6-8-26(9-7-23)31(36)22-28-12-15-32(25(3)24(28)2)39-33(37)27-10-13-30(14-11-27)38-21-20-35-18-16-29(17-19-35)34(4)5/h6-19H,20-22H2,1-5H3/q+1 |
| InChIKey | PCMBAJGEFZMDJO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|