C18H21F4N2O4+ — CID 161050479
1-[2-(2-fluoro-4-methylphenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine;2,2,2-trifluoroethaneperoxoic acid (PubChem CID 161050479) has the molecular formula C18H21F4N2O4+ and a molecular weight of 405.37 g/mol. Its IUPAC name is 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine;2,2,2-trifluoroethaneperoxoic acid.
| Compound Name | 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine;2,2,2-trifluoroethaneperoxoic acid |
|---|---|
| PubChem CID | 161050479 |
| Molecular Formula | C18H21F4N2O4+ |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[2-(2-fluoro-4-methylphenoxy)ethyl]-N,N-dimethylpyridin-1-ium-4-amine;2,2,2-trifluoroethaneperoxoic acid |
| SMILES | Cc1ccc(OCC[n+]2ccc(N(C)C)cc2)c(F)c1.O=C(OO)C(F)(F)F |
| InChI | InChI=1S/C16H20FN2O.C2HF3O3/c1-13-4-5-16(15(17)12-13)20-11-10-19-8-6-14(7-9-19)18(2)3;3-2(4,5)1(6)8-7/h4-9,12H,10-11H2,1-3H3;7H/q+1; |
| InChIKey | MUSXCWBNZJATMZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|