C16H19FNO4S+ — CID 21333655
2-[1-[2-(2-fluoro-4-methylphenoxy)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid (PubChem CID 21333655) has the molecular formula C16H19FNO4S+ and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[1-[2-(2-fluoro-4-methylphenoxy)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid.
| Compound Name | 2-[1-[2-(2-fluoro-4-methylphenoxy)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 21333655 |
| Molecular Formula | C16H19FNO4S+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[1-[2-(2-fluoro-4-methylphenoxy)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid |
| SMILES | Cc1ccc(OCC[n+]2ccc(CCS(=O)(=O)O)cc2)c(F)c1 |
| InChI | InChI=1S/C16H18FNO4S/c1-13-2-3-16(15(17)12-13)22-10-9-18-7-4-14(5-8-18)6-11-23(19,20)21/h2-5,7-8,12H,6,9-11H2,1H3/p+1 |
| InChIKey | KKNXTHBOCGLTOO-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|