C15H20N2O3S+2 — CID 4304738
2-[1-[2-(3-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid (PubChem CID 4304738) has the molecular formula C15H20N2O3S+2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[1-[2-(3-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid.
| Compound Name | 2-[1-[2-(3-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 4304738 |
| Molecular Formula | C15H20N2O3S+2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[1-[2-(3-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium-4-yl]ethanesulfonic acid |
| SMILES | Cc1ccc[n+](CC[n+]2ccc(CCS(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C15H19N2O3S/c1-14-3-2-7-17(13-14)11-10-16-8-4-15(5-9-16)6-12-21(18,19)20/h2-5,7-9,13H,6,10-12H2,1H3/q+1/p+1 |
| InChIKey | ACDQUMXEGAGRGK-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|