C14H23N2O+ — CID 156729891
ethane;2-methyl-N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]prop-2-enamide (PubChem CID 156729891) has the molecular formula C14H23N2O+ and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;2-methyl-N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]prop-2-enamide.
| Compound Name | ethane;2-methyl-N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 156729891 |
| Molecular Formula | C14H23N2O+ |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | ethane;2-methyl-N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCC[n+]1cccc(C)c1.CC |
| InChI | InChI=1S/C12H16N2O.C2H6/c1-10(2)12(15)13-6-8-14-7-4-5-11(3)9-14;1-2/h4-5,7,9H,1,6,8H2,2-3H3;1-2H3/p+1 |
| InChIKey | PTNIRUKXAOWWAC-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|