C11H19N2+ — CID 167371032
N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]propan-2-amine (PubChem CID 167371032) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 167371032 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | N-[2-(3-methylpyridin-1-ium-1-yl)ethyl]propan-2-amine |
| SMILES | Cc1ccc[n+](CCNC(C)C)c1 |
| InChI | InChI=1S/C11H19N2/c1-10(2)12-6-8-13-7-4-5-11(3)9-13/h4-5,7,9-10,12H,6,8H2,1-3H3/q+1 |
| InChIKey | IKRJSRDSLXLKHF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|