C15H22Cl2N4 — CID 46846045
1-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-N,N-dimethylpyridin-1-ium-4-amine dichloride (PubChem CID 46846045) has the molecular formula C15H22Cl2N4 and a molecular weight of 329.28 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-N,N-dimethylpyridin-1-ium-4-amine dichloride.
| Compound Name | 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-N,N-dimethylpyridin-1-ium-4-amine dichloride |
|---|---|
| PubChem CID | 46846045 |
| Molecular Formula | C15H22Cl2N4 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-N,N-dimethylpyridin-1-ium-4-amine dichloride |
| SMILES | CN(C)c1cc[n+](C[n+]2ccc(N(C)C)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C15H22N4.2ClH/c1-16(2)14-5-9-18(10-6-14)13-19-11-7-15(8-12-19)17(3)4;;/h5-12H,13H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | SFYJQLARHNEWHF-UHFFFAOYSA-L |
| XLogP | -5.09 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|