C8H12Cl2N2 — CID 10512500
1-(chloromethyl)-N,N-dimethylpyridin-1-ium-4-amine chloride (PubChem CID 10512500) has the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. Its IUPAC name is 1-(chloromethyl)-N,N-dimethylpyridin-1-ium-4-amine chloride.
| Compound Name | 1-(chloromethyl)-N,N-dimethylpyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 10512500 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-(chloromethyl)-N,N-dimethylpyridin-1-ium-4-amine chloride |
| SMILES | CN(C)c1cc[n+](CCl)cc1.[Cl-] |
| InChI | InChI=1S/C8H12ClN2.ClH/c1-10(2)8-3-5-11(7-9)6-4-8;/h3-6H,7H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HGYVKOYMZXMPMG-UHFFFAOYSA-M |
| XLogP | -1.76 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|