C10H13Br3N2 — CID 13172040
1-[(E)-2,3-dibromoprop-2-enyl]-N,N-dimethylpyridin-1-ium-4-amine bromide (PubChem CID 13172040) has the molecular formula C10H13Br3N2 and a molecular weight of 400.94 g/mol. Its IUPAC name is 1-[(E)-2,3-dibromoprop-2-enyl]-N,N-dimethylpyridin-1-ium-4-amine bromide.
| Compound Name | 1-[(E)-2,3-dibromoprop-2-enyl]-N,N-dimethylpyridin-1-ium-4-amine bromide |
|---|---|
| PubChem CID | 13172040 |
| Molecular Formula | C10H13Br3N2 |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 397.86 |
| IUPAC Name | 1-[(E)-2,3-dibromoprop-2-enyl]-N,N-dimethylpyridin-1-ium-4-amine bromide |
| SMILES | CN(C)c1cc[n+](C/C(Br)=C\Br)cc1.[Br-] |
| InChI | InChI=1S/C10H13Br2N2.BrH/c1-13(2)10-3-5-14(6-4-10)8-9(12)7-11;/h3-7H,8H2,1-2H3;1H/q+1;/p-1/b9-7+; |
| InChIKey | NZJCTLCUZUMAPP-BXTVWIJMSA-M |
| XLogP | -0.32 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|