C21H22N3O+ — CID 3165547
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N,N-diphenylacetamide (PubChem CID 3165547) has the molecular formula C21H22N3O+ and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N,N-diphenylacetamide.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 3165547 |
| Molecular Formula | C21H22N3O+ |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N,N-diphenylacetamide |
| SMILES | CN(C)c1cc[n+](CC(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N3O/c1-22(2)18-13-15-23(16-14-18)17-21(25)24(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16H,17H2,1-2H3/q+1 |
| InChIKey | JNTNYGUMTXUATO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|