C25H28N3O2+ — CID 102360900
2-[4-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]acetic acid (PubChem CID 102360900) has the molecular formula C25H28N3O2+ and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-[4-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[4-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 102360900 |
| Molecular Formula | C25H28N3O2+ |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[4-[2,2-bis[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]acetic acid |
| SMILES | CN(C)c1ccc(C(=Cc2cc[n+](CC(=O)O)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-26(2)22-9-5-20(6-10-22)24(21-7-11-23(12-8-21)27(3)4)17-19-13-15-28(16-14-19)18-25(29)30/h5-17H,18H2,1-4H3/p+1 |
| InChIKey | CTMDICXOJJWHCR-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 47.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|