C18H21N5O — CID 91051497
2-cyano-1-(5-phenoxypentyl)-1-pyridin-4-ylguanidine (PubChem CID 91051497) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-cyano-1-(5-phenoxypentyl)-1-pyridin-4-ylguanidine.
| Compound Name | 2-cyano-1-(5-phenoxypentyl)-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 91051497 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-cyano-1-(5-phenoxypentyl)-1-pyridin-4-ylguanidine |
| SMILES | N#C/N=C(\N)N(CCCCCOc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C18H21N5O/c19-15-22-18(20)23(16-9-11-21-12-10-16)13-5-2-6-14-24-17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-14H2,(H2,20,22) |
| InChIKey | VEIGQGBLBZLSDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|