6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid

C13H17N5O2 — CID 154374356

IUPAC6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid
SMILESN#CN(CCCCCC(=O)O)/C(N)=N/c1ccncc1
InChIInChI=1S/C13H17N5O2/c14-10-18(9-3-1-2-4-12(19)20)13(15)17-11-5-7-16-8-6-11/h5-8H,1-4,9H2,(H,19,20)(H2,15,16,17)
InChIKeyAOKJEIFVDCHJHH-UHFFFAOYSA-N
MW275.31 g/mol
LogP1.46
Rot. Bonds7

About 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid

6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid (PubChem CID 154374356) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid.

Molecular Properties

Compound Name6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid
PubChem CID154374356
Molecular FormulaC13H17N5O2
Molecular Weight275.31 g/mol
Exact Mass275.14
IUPAC Name6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid
SMILESN#CN(CCCCCC(=O)O)/C(N)=N/c1ccncc1
InChIInChI=1S/C13H17N5O2/c14-10-18(9-3-1-2-4-12(19)20)13(15)17-11-5-7-16-8-6-11/h5-8H,1-4,9H2,(H,19,20)(H2,15,16,17)
InChIKeyAOKJEIFVDCHJHH-UHFFFAOYSA-N
XLogP1.46
TPSA115.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.31
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid?
The IUPAC name of 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid (CID 154374356) is 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid.
What is the SMILES notation for 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid?
The canonical SMILES for 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid is N#CN(CCCCCC(=O)O)/C(N)=N/c1ccncc1.
What is the InChIKey of 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid?
The InChIKey is AOKJEIFVDCHJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2/c14-10-18(9-3-1-2-4-12(19)20)13(15)17-11-5-7-16-8-6-11/h5-8H,1-4,9H2,(H,19,20)(H2,15,16,17).
What are the key properties of 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid?
6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid has a molecular weight of 275.31 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]hexanoic acid is sourced from PubChem (CID 154374356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).