C20H24N10 — CID 54410768
1-cyano-1-[6-[cyano-(N'-pyridin-3-ylcarbamimidoyl)amino]hexyl]-2-pyridin-3-ylguanidine (PubChem CID 54410768) has the molecular formula C20H24N10 and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-cyano-1-[6-[cyano-(N'-pyridin-3-ylcarbamimidoyl)amino]hexyl]-2-pyridin-3-ylguanidine.
| Compound Name | 1-cyano-1-[6-[cyano-(N'-pyridin-3-ylcarbamimidoyl)amino]hexyl]-2-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 54410768 |
| Molecular Formula | C20H24N10 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-cyano-1-[6-[cyano-(N'-pyridin-3-ylcarbamimidoyl)amino]hexyl]-2-pyridin-3-ylguanidine |
| SMILES | N#CN(CCCCCCN(C#N)/C(N)=N/c1cccnc1)/C(N)=N/c1cccnc1 |
| InChI | InChI=1S/C20H24N10/c21-15-29(19(23)27-17-7-5-9-25-13-17)11-3-1-2-4-12-30(16-22)20(24)28-18-8-6-10-26-14-18/h5-10,13-14H,1-4,11-12H2,(H2,23,27)(H2,24,28) |
| InChIKey | VTYKNTFBQSVIEG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|