About N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide
N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide (PubChem CID 3050756) has the molecular formula C12H15N5
and a molecular weight of 229.29 g/mol. Its IUPAC name is N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide |
| PubChem CID | 3050756 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide |
| SMILES | N#CN/C(=N\c1cccnc1)N1CCCCC1 |
| InChI | InChI=1S/C12H15N5/c13-10-15-12(17-7-2-1-3-8-17)16-11-5-4-6-14-9-11/h4-6,9H,1-3,7-8H2,(H,15,16) |
| InChIKey | RNJAABBLQFFNQW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide?
The IUPAC name of N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide (CID 3050756) is N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide.
What is the SMILES notation for N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide?
The canonical SMILES for N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide is N#CN/C(=N\c1cccnc1)N1CCCCC1.
What is the InChIKey of N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide?
The InChIKey is RNJAABBLQFFNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5/c13-10-15-12(17-7-2-1-3-8-17)16-11-5-4-6-14-9-11/h4-6,9H,1-3,7-8H2,(H,15,16).
What are the key properties of N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide?
N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide has a molecular weight of 229.29 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide is sourced from PubChem (CID 3050756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).