C12H15N5 — CID 3050756
N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide (PubChem CID 3050756) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide.
| Compound Name | N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 3050756 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-cyano-N'-pyridin-3-ylpiperidine-1-carboximidamide |
| SMILES | N#CN/C(=N\c1cccnc1)N1CCCCC1 |
| InChI | InChI=1S/C12H15N5/c13-10-15-12(17-7-2-1-3-8-17)16-11-5-4-6-14-9-11/h4-6,9H,1-3,7-8H2,(H,15,16) |
| InChIKey | RNJAABBLQFFNQW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|