C19H28N6O2S — CID 10408953
N-cyano-N'-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboximidamide (PubChem CID 10408953) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-cyano-N'-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboximidamide.
| Compound Name | N-cyano-N'-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 10408953 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-cyano-N'-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboximidamide |
| SMILES | N#CN/C(=N\S(=O)(=O)c1cnccc1NC1CCCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C19H28N6O2S/c20-15-22-19(25-12-6-3-7-13-25)24-28(26,27)18-14-21-11-10-17(18)23-16-8-4-1-2-5-9-16/h10-11,14,16H,1-9,12-13H2,(H,21,23)(H,22,24) |
| InChIKey | GMUZNZCMANNIJM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|