C14H21N3O2S3 — CID 10044029
[4-(cyclooctylamino)-3-pyridinyl]sulfonylcarbamodithioic acid (PubChem CID 10044029) has the molecular formula C14H21N3O2S3 and a molecular weight of 359.54 g/mol. Its IUPAC name is [4-(cyclooctylamino)-3-pyridinyl]sulfonylcarbamodithioic acid.
| Compound Name | [4-(cyclooctylamino)-3-pyridinyl]sulfonylcarbamodithioic acid |
|---|---|
| PubChem CID | 10044029 |
| Molecular Formula | C14H21N3O2S3 |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [4-(cyclooctylamino)-3-pyridinyl]sulfonylcarbamodithioic acid |
| SMILES | O=S(=O)(NC(=S)S)c1cnccc1NC1CCCCCCC1 |
| InChI | InChI=1S/C14H21N3O2S3/c18-22(19,17-14(20)21)13-10-15-9-8-12(13)16-11-6-4-2-1-3-5-7-11/h8-11H,1-7H2,(H,15,16)(H2,17,20,21) |
| InChIKey | ZZUOXCMACLILCO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|