C15H22N6O2S — CID 10247317
1-cyano-3-[[4-(cyclopentylamino)-3-pyridinyl]sulfonyl]-2-propan-2-ylguanidine (PubChem CID 10247317) has the molecular formula C15H22N6O2S and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-cyano-3-[[4-(cyclopentylamino)-3-pyridinyl]sulfonyl]-2-propan-2-ylguanidine.
| Compound Name | 1-cyano-3-[[4-(cyclopentylamino)-3-pyridinyl]sulfonyl]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 10247317 |
| Molecular Formula | C15H22N6O2S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-cyano-3-[[4-(cyclopentylamino)-3-pyridinyl]sulfonyl]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\NC#N)NS(=O)(=O)c1cnccc1NC1CCCC1 |
| InChI | InChI=1S/C15H22N6O2S/c1-11(2)19-15(18-10-16)21-24(22,23)14-9-17-8-7-13(14)20-12-5-3-4-6-12/h7-9,11-12H,3-6H2,1-2H3,(H,17,20)(H2,18,19,21) |
| InChIKey | AAFJRGIBPOYICN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|