C18H28N4O3S — CID 10385136
N-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboxamide (PubChem CID 10385136) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboxamide.
| Compound Name | N-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 10385136 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-[[4-(cycloheptylamino)-3-pyridinyl]sulfonyl]piperidine-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cnccc1NC1CCCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H28N4O3S/c23-18(22-12-6-3-7-13-22)21-26(24,25)17-14-19-11-10-16(17)20-15-8-4-1-2-5-9-15/h10-11,14-15H,1-9,12-13H2,(H,19,20)(H,21,23) |
| InChIKey | PRGISWGULNLCKV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |