C16H26N4O2S2 — CID 3025730
1-[[4-(cyclooctylamino)-3-pyridinyl]sulfonyl]-3-ethylthiourea (PubChem CID 3025730) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[[4-(cyclooctylamino)-3-pyridinyl]sulfonyl]-3-ethylthiourea.
| Compound Name | 1-[[4-(cyclooctylamino)-3-pyridinyl]sulfonyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 3025730 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[[4-(cyclooctylamino)-3-pyridinyl]sulfonyl]-3-ethylthiourea |
| SMILES | CCNC(=S)NS(=O)(=O)c1cnccc1NC1CCCCCCC1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-2-18-16(23)20-24(21,22)15-12-17-11-10-14(15)19-13-8-6-4-3-5-7-9-13/h10-13H,2-9H2,1H3,(H,17,19)(H2,18,20,23) |
| InChIKey | HACAXCYSHKSNPR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|