C15H23N5O4S — CID 23238854
4-(cyclopentylamino)-N-[2-nitro-1-(propan-2-ylamino)ethenyl]pyridine-3-sulfonamide (PubChem CID 23238854) has the molecular formula C15H23N5O4S and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-(cyclopentylamino)-N-[2-nitro-1-(propan-2-ylamino)ethenyl]pyridine-3-sulfonamide.
| Compound Name | 4-(cyclopentylamino)-N-[2-nitro-1-(propan-2-ylamino)ethenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 23238854 |
| Molecular Formula | C15H23N5O4S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-(cyclopentylamino)-N-[2-nitro-1-(propan-2-ylamino)ethenyl]pyridine-3-sulfonamide |
| SMILES | CC(C)NC(=C[N+](=O)[O-])NS(=O)(=O)c1cnccc1NC1CCCC1 |
| InChI | InChI=1S/C15H23N5O4S/c1-11(2)17-15(10-20(21)22)19-25(23,24)14-9-16-8-7-13(14)18-12-5-3-4-6-12/h7-12,17,19H,3-6H2,1-2H3,(H,16,18) |
| InChIKey | BVFNCEOCCNHVJS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|