C10H12FN3O — CID 103886195
N-(3-fluoro-4-pyridinyl)pyrrolidine-1-carboxamide (PubChem CID 103886195) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is N-(3-fluoro-4-pyridinyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-fluoro-4-pyridinyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 103886195 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-(3-fluoro-4-pyridinyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccncc1F)N1CCCC1 |
| InChI | InChI=1S/C10H12FN3O/c11-8-7-12-4-3-9(8)13-10(15)14-5-1-2-6-14/h3-4,7H,1-2,5-6H2,(H,12,13,15) |
| InChIKey | FYHRTORMMNSFNP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |