C20H23N5O4 — CID 88789882
N-cyano-N'-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1,4-diazepane-1-carboximidamide (PubChem CID 88789882) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-cyano-N'-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1,4-diazepane-1-carboximidamide.
| Compound Name | N-cyano-N'-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1,4-diazepane-1-carboximidamide |
|---|---|
| PubChem CID | 88789882 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-cyano-N'-(3,4-dimethoxyphenyl)-4-(furan-2-carbonyl)-1,4-diazepane-1-carboximidamide |
| SMILES | COc1ccc(/N=C(\NC#N)N2CCCN(C(=O)c3ccco3)CC2)cc1OC |
| InChI | InChI=1S/C20H23N5O4/c1-27-16-7-6-15(13-18(16)28-2)23-20(22-14-21)25-9-4-8-24(10-11-25)19(26)17-5-3-12-29-17/h3,5-7,12-13H,4,8-11H2,1-2H3,(H,22,23) |
| InChIKey | GZGDPRSRPLEQJB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|