C19H25N5O4 — CID 151289623
N-cyano-N'-(3,4-dimethoxyphenyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 151289623) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-cyano-N'-(3,4-dimethoxyphenyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-(3,4-dimethoxyphenyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 151289623 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-cyano-N'-(3,4-dimethoxyphenyl)-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | COc1ccc(/N=C(\NC#N)N2CCN(C(=O)C3CCCO3)CC2)cc1OC |
| InChI | InChI=1S/C19H25N5O4/c1-26-15-6-5-14(12-17(15)27-2)22-19(21-13-20)24-9-7-23(8-10-24)18(25)16-4-3-11-28-16/h5-6,12,16H,3-4,7-11H2,1-2H3,(H,21,22) |
| InChIKey | OADQFWBPFMNXLH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|