C22H35IN4O5 — CID 111302262
N-ethyl-4-(oxolane-2-carbonyl)-N'-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111302262) has the molecular formula C22H35IN4O5 and a molecular weight of 562.45 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111302262 |
| Molecular Formula | C22H35IN4O5 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[(2,4,5-trimethoxyphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C22H34N4O5.HI/c1-5-23-22(24-15-16-13-19(29-3)20(30-4)14-18(16)28-2)26-10-8-25(9-11-26)21(27)17-7-6-12-31-17;/h13-14,17H,5-12,15H2,1-4H3,(H,23,24);1H |
| InChIKey | HQJZTQIYUJXDRZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|