C17H26BrIN4O2S — CID 111301714
N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111301714) has the molecular formula C17H26BrIN4O2S and a molecular weight of 557.30 g/mol. Its IUPAC name is N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111301714 |
| Molecular Formula | C17H26BrIN4O2S |
| Molecular Weight | 557.30 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | N'-[(4-bromothiophen-2-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C17H25BrN4O2S.HI/c1-2-19-17(20-11-14-10-13(18)12-25-14)22-7-5-21(6-8-22)16(23)15-4-3-9-24-15;/h10,12,15H,2-9,11H2,1H3,(H,19,20);1H |
| InChIKey | QUSKRWIKCFVDGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|