C20H34IN5O2S — CID 111300766
N'-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111300766) has the molecular formula C20H34IN5O2S and a molecular weight of 535.50 g/mol. Its IUPAC name is N'-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111300766 |
| Molecular Formula | C20H34IN5O2S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N'-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C20H33N5O2S.HI/c1-5-21-19(22-13-15-14-28-18(23-15)20(2,3)4)25-10-8-24(9-11-25)17(26)16-7-6-12-27-16;/h14,16H,5-13H2,1-4H3,(H,21,22);1H |
| InChIKey | VLFDAFAPIWOJQC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|