C22H29N5O2S — CID 111301067
N-ethyl-4-(oxolane-2-carbonyl)-N'-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111301067) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-ethyl-4-(oxolane-2-carbonyl)-N'-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301067 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-ethyl-4-(oxolane-2-carbonyl)-N'-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccccc2)cs1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H29N5O2S/c1-2-23-22(24-15-20-25-18(16-30-20)17-7-4-3-5-8-17)27-12-10-26(11-13-27)21(28)19-9-6-14-29-19/h3-5,7-8,16,19H,2,6,9-15H2,1H3,(H,23,24) |
| InChIKey | WQUKTMNJPVYYIF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|