C21H27N5O2S — CID 111302953
N'-methyl-4-(oxolane-2-carbonyl)-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111302953) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111302953 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nc(-c2ccccc2)cs1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H27N5O2S/c1-22-21(23-14-19-24-17(15-29-19)16-6-3-2-4-7-16)26-11-9-25(10-12-26)20(27)18-8-5-13-28-18/h2-4,6-7,15,18H,5,8-14H2,1H3,(H,22,23) |
| InChIKey | PYQZXUKVMHBXLA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|