C16H25N5O2S — CID 111514832
N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111514832) has the molecular formula C16H25N5O2S and a molecular weight of 351.48 g/mol. Its IUPAC name is N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111514832 |
| Molecular Formula | C16H25N5O2S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H25N5O2S/c1-12-10-18-14(24-12)11-19-16(17-2)21-7-5-20(6-8-21)15(22)13-4-3-9-23-13/h10,13H,3-9,11H2,1-2H3,(H,17,19) |
| InChIKey | OBAKDTLSSCLPTJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|