C16H27N7O2 — CID 111301311
N-ethyl-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301311) has the molecular formula C16H27N7O2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301311 |
| Molecular Formula | C16H27N7O2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-ethyl-N'-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nncn1C)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C16H27N7O2/c1-3-17-16(18-11-14-20-19-12-21(14)2)23-8-6-22(7-9-23)15(24)13-5-4-10-25-13/h12-13H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | BUSVCAWEDOZHLH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|