C22H34N4O5 — CID 111300483
N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111300483) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111300483 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H34N4O5/c1-3-23-22(24-16-17-6-7-18(31-14-12-27)20(15-17)29-2)26-10-8-25(9-11-26)21(28)19-5-4-13-30-19/h6-7,15,19,27H,3-5,8-14,16H2,1-2H3,(H,23,24) |
| InChIKey | LJQCLOMADXXQOE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|