C20H33IN4O5 — CID 111164502
ethyl 4-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164502) has the molecular formula C20H33IN4O5 and a molecular weight of 536.41 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164502 |
| Molecular Formula | C20H33IN4O5 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C20H32N4O5.HI/c1-4-21-19(23-8-10-24(11-9-23)20(26)28-5-2)22-15-16-6-7-17(29-13-12-25)18(14-16)27-3;/h6-7,14,25H,4-5,8-13,15H2,1-3H3,(H,21,22);1H |
| InChIKey | SKPZODZHNANTKC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|