C23H37N5O4 — CID 111367189
N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide (PubChem CID 111367189) has the molecular formula C23H37N5O4 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367189 |
| Molecular Formula | C23H37N5O4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N1CCN(CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C23H37N5O4/c1-3-24-23(25-17-19-6-7-20(32-15-14-29)21(16-19)31-2)28-12-10-26(11-13-28)18-22(30)27-8-4-5-9-27/h6-7,16,29H,3-5,8-15,17-18H2,1-2H3,(H,24,25) |
| InChIKey | MACZWXOQTOVLTP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|