C21H34IN3O5 — CID 110994412
ethyl 1-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994412) has the molecular formula C21H34IN3O5 and a molecular weight of 535.42 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994412 |
| Molecular Formula | C21H34IN3O5 |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCCO)c(OC)c1)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C21H33N3O5.HI/c1-4-22-21(24-10-6-7-17(15-24)20(26)28-5-2)23-14-16-8-9-18(29-12-11-25)19(13-16)27-3;/h8-9,13,17,25H,4-7,10-12,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | PYIFQWOOJQADDT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|