C20H25N3O5 — CID 110397663
N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-3,4-dimethoxybenzamide (PubChem CID 110397663) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 110397663 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCN2CCN(C(=O)c3ccco3)CC2)cc1OC |
| InChI | InChI=1S/C20H25N3O5/c1-26-16-6-5-15(14-18(16)27-2)19(24)21-7-8-22-9-11-23(12-10-22)20(25)17-4-3-13-28-17/h3-6,13-14H,7-12H2,1-2H3,(H,21,24) |
| InChIKey | KDAXHMYCXGTAHL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |