C12H17N5 — CID 22027391
1-cyano-1-(2-methylbutan-2-yl)-2-pyridin-3-ylguanidine (PubChem CID 22027391) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-cyano-1-(2-methylbutan-2-yl)-2-pyridin-3-ylguanidine.
| Compound Name | 1-cyano-1-(2-methylbutan-2-yl)-2-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 22027391 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-cyano-1-(2-methylbutan-2-yl)-2-pyridin-3-ylguanidine |
| SMILES | CCC(C)(C)N(C#N)/C(N)=N/c1cccnc1 |
| InChI | InChI=1S/C12H17N5/c1-4-12(2,3)17(9-13)11(14)16-10-6-5-7-15-8-10/h5-8H,4H2,1-3H3,(H2,14,16) |
| InChIKey | PBWNRWGRCIGGFS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|