C27H45N7O3S — CID 89051828
2-cyano-1-[8-[cyclopentylsulfonyl(3-morpholin-4-ylpropyl)amino]octyl]-1-pyridin-4-ylguanidine (PubChem CID 89051828) has the molecular formula C27H45N7O3S and a molecular weight of 547.77 g/mol. Its IUPAC name is 2-cyano-1-[8-[cyclopentylsulfonyl(3-morpholin-4-ylpropyl)amino]octyl]-1-pyridin-4-ylguanidine.
| Compound Name | 2-cyano-1-[8-[cyclopentylsulfonyl(3-morpholin-4-ylpropyl)amino]octyl]-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 89051828 |
| Molecular Formula | C27H45N7O3S |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 2-cyano-1-[8-[cyclopentylsulfonyl(3-morpholin-4-ylpropyl)amino]octyl]-1-pyridin-4-ylguanidine |
| SMILES | N#C/N=C(\N)N(CCCCCCCCN(CCCN1CCOCC1)S(=O)(=O)C1CCCC1)c1ccncc1 |
| InChI | InChI=1S/C27H45N7O3S/c28-24-31-27(29)34(25-12-14-30-15-13-25)19-8-4-2-1-3-7-17-33(38(35,36)26-10-5-6-11-26)18-9-16-32-20-22-37-23-21-32/h12-15,26H,1-11,16-23H2,(H2,29,31) |
| InChIKey | XHZWVIOFLCOCIO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|