C26H35ClN5O6+ — CID 118221534
[[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]-[2-(2-methoxyethoxy)ethoxy]methyl] formate (PubChem CID 118221534) has the molecular formula C26H35ClN5O6+ and a molecular weight of 549.05 g/mol. Its IUPAC name is [[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]-[2-(2-methoxyethoxy)ethoxy]methyl] formate.
| Compound Name | [[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]-[2-(2-methoxyethoxy)ethoxy]methyl] formate |
|---|---|
| PubChem CID | 118221534 |
| Molecular Formula | C26H35ClN5O6+ |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | [[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]-[2-(2-methoxyethoxy)ethoxy]methyl] formate |
| SMILES | COCCOCCOC(OC=O)[n+]1ccc(N(CCCCCCOc2ccc(Cl)cc2)/C(N)=N/C#N)cc1 |
| InChI | InChI=1S/C26H35ClN5O6/c1-34-16-17-35-18-19-37-26(38-21-33)31-13-10-23(11-14-31)32(25(29)30-20-28)12-4-2-3-5-15-36-24-8-6-22(27)7-9-24/h6-11,13-14,21,26H,2-5,12,15-19H2,1H3,(H2,29,30)/q+1 |
| InChIKey | ZTCZIMUPDAYDLG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|