C28H38ClN6O5+ — CID 90768720
[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl 2-piperidin-4-yloxyethyl carbonate (PubChem CID 90768720) has the molecular formula C28H38ClN6O5+ and a molecular weight of 574.10 g/mol. Its IUPAC name is [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl 2-piperidin-4-yloxyethyl carbonate.
| Compound Name | [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl 2-piperidin-4-yloxyethyl carbonate |
|---|---|
| PubChem CID | 90768720 |
| Molecular Formula | C28H38ClN6O5+ |
| Molecular Weight | 574.10 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl 2-piperidin-4-yloxyethyl carbonate |
| SMILES | N#C/N=C(\N)N(CCCCCCOc1ccc(Cl)cc1)c1cc[n+](COC(=O)OCCOC2CCNCC2)cc1 |
| InChI | InChI=1S/C28H38ClN6O5/c29-23-5-7-25(8-6-23)37-18-4-2-1-3-15-35(27(31)33-21-30)24-11-16-34(17-12-24)22-40-28(36)39-20-19-38-26-9-13-32-14-10-26/h5-8,11-12,16-17,26,32H,1-4,9-10,13-15,18-20,22H2,(H2,31,33)/q+1 |
| InChIKey | UAAVPDLDQOGRCB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 135.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|