C30H42ClN5O8 — CID 73073124
[4-[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]imino-1-pyridinyl]methyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl carbonate (PubChem CID 73073124) has the molecular formula C30H42ClN5O8 and a molecular weight of 636.15 g/mol. Its IUPAC name is [4-[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]imino-1-pyridinyl]methyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl carbonate.
| Compound Name | [4-[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]imino-1-pyridinyl]methyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl carbonate |
|---|---|
| PubChem CID | 73073124 |
| Molecular Formula | C30H42ClN5O8 |
| Molecular Weight | 636.15 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | [4-[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]imino-1-pyridinyl]methyl 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl carbonate |
| SMILES | COCCOCCOCCOCCOC(=O)OCn1ccc(=N/C(=N/CCCCCCOc2ccc(Cl)cc2)NC#N)cc1 |
| InChI | InChI=1S/C30H42ClN5O8/c1-38-16-17-39-18-19-40-20-21-41-22-23-43-30(37)44-25-36-13-10-27(11-14-36)35-29(34-24-32)33-12-4-2-3-5-15-42-28-8-6-26(31)7-9-28/h6-11,13-14H,2-5,12,15-23,25H2,1H3,(H,33,34) |
| InChIKey | RXXJCNMVVRGOJB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|