C16H22N8O2 — CID 86121328
2-[3-[4-[3-[[amino-(cyanoamino)methylidene]amino]propoxy]phenoxy]propyl]-1-cyanoguanidine (PubChem CID 86121328) has the molecular formula C16H22N8O2 and a molecular weight of 358.41 g/mol. Its IUPAC name is 2-[3-[4-[3-[[amino-(cyanoamino)methylidene]amino]propoxy]phenoxy]propyl]-1-cyanoguanidine.
| Compound Name | 2-[3-[4-[3-[[amino-(cyanoamino)methylidene]amino]propoxy]phenoxy]propyl]-1-cyanoguanidine |
|---|---|
| PubChem CID | 86121328 |
| Molecular Formula | C16H22N8O2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[3-[4-[3-[[amino-(cyanoamino)methylidene]amino]propoxy]phenoxy]propyl]-1-cyanoguanidine |
| SMILES | N#CN/C(N)=N/CCCOc1ccc(OCCC/N=C(\N)NC#N)cc1 |
| InChI | InChI=1S/C16H22N8O2/c17-11-23-15(19)21-7-1-9-25-13-3-5-14(6-4-13)26-10-2-8-22-16(20)24-12-18/h3-6H,1-2,7-10H2,(H3,19,21,23)(H3,20,22,24) |
| InChIKey | KPYABFIGAKJTGW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|