C17H26FN5O3 — CID 155698904
N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(4-fluorophenoxy)-2-hydroxyhexan-3-yl]formamide;ethane (PubChem CID 155698904) has the molecular formula C17H26FN5O3 and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(4-fluorophenoxy)-2-hydroxyhexan-3-yl]formamide;ethane.
| Compound Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(4-fluorophenoxy)-2-hydroxyhexan-3-yl]formamide;ethane |
|---|---|
| PubChem CID | 155698904 |
| Molecular Formula | C17H26FN5O3 |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[6-[[amino-(cyanoamino)methylidene]amino]-1-(4-fluorophenoxy)-2-hydroxyhexan-3-yl]formamide;ethane |
| SMILES | CC.N#CN/C(N)=N/CCCC(NC=O)C(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FN5O3.C2H6/c16-11-3-5-12(6-4-11)24-8-14(23)13(21-10-22)2-1-7-19-15(18)20-9-17;1-2/h3-6,10,13-14,23H,1-2,7-8H2,(H,21,22)(H3,18,19,20);1-2H3 |
| InChIKey | WRNWRGYEEFMYMY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|